revox-peptides-opiniones The RGD peptide, a short amino acid sequence comprising Arginine-Glycine-Aspartic acid, plays a crucial role in cell adhesion and has garnered significant attention in various scientific and medical fieldsPeptide Calculator - Bachem. Understanding its molecular weight is fundamental to characterizing and utilizing this peptide.
The molecular weight of the RGD peptide can vary depending on its specific sequence and modifications.Catalog Num, A15538. Formula, C12H22N6O6.Molecular Weight, 346.34. CAS Number, 99896-85-2. SMILES, C(CC(C(=O)NCC(=O)NC(CC(=O)O)C(=O)O)N)CN=C(N)N. For the basic tripeptide sequence Arg-Gly-Asp (RGD), the molecular weight is approximately 346RGD peptide | CRB1001012.34 g/mol. This is often represented by the molecular formula C12H22N6O6RGD(Arg-Gly-Asp)Peptides;Formula. C 12H 22N 6O ; CAS No. 99896-85-2 ; Storage, 3 years -20℃Powder ; Syonnyms, Arginine-Glycine-Aspartic Acid ; Water, 12 mg/mL .... This fundamental RGD peptide sequence is a minimal recognition motif for integrin binding, making it a potent integrin inhibitor.Molecular Weight.612.7 g/mol. Computed by PubChem 2.2 (PubChem release 2021.10.14) ; IUPAC Condensed. H-DL-Tyr-DL-Arg-Gly-DL-Asp-DL-Cys-OH ; Sequence. YRGDC ; PLN.
However, the RGD peptide can exist in various forms, leading to different molecular weightscyclic RGD | C24H36N8O9S | CID 156963324 - PubChem - NIH. For instance, the RGD peptide sequence GRGDNP has a molecular weight of 614.61 g/mol. Another common variant, cyclic RGD, can have a molecular weight of 612.7 g/mol or 578.7 g/mol, depending on the specific cyclic structure and any additional modifications. Some research also explores longer peptide chains incorporating the RGD motif, such as Fmoc-Phe-Phe-Gly-Gly-Arg-Gly-Asp, which exhibits a molecular weight of 977.05. The precise molecular weight is critical for accurate dosing and formulation in research and therapeutic applications.
The structure of the RGD peptide is relatively simple, consisting of three amino acids linked by peptide bonds. The presence of the aspartic acid residue with its negatively charged side chain is crucial for its interaction with integrins.cyclic RGD | C24H36N8O9S | CID 156963324 - PubChem - NIH The RGD sequence is a common motif found in extracellular matrix (ECM) proteins, facilitating cell adhesion to these structures. The RGD motif is recognized by various integrin receptors, including $\alpha$v$\beta$3 and $\alpha$5$\beta$1.RGD peptide (GRGDNP) (TFA)
Beyond the basic tripeptide, researchers have synthesized numerous RGD peptides with modified sequences and structures to enhance their specificity and efficacyRGD (Arg-Gly-Asp) Peptides. These include cyclic RGD peptides and those conjugated to other molecules or nanoparticles for targeted drug delivery.Rgd peptide The ability to synthesize RGD peptides with specific molecular weights and properties allows for their tailored application in diverse areasRGD peptides | Life Sciences.
The RGD peptide has found applications in various fields due to its ability to modulate cell adhesion and signaling. In cancer research, RGD peptides are explored for their potential in tumor targeting and inhibiting angiogenesis, the formation of new blood vessels that feed tumors. Their ability to bind to integrins overexpressed on cancer cells makes them attractive candidates for diagnostic imaging and therapeutic delivery systems.
Furthermore, RGD peptides are investigated for their role in wound healing, tissue engineering, and regenerative medicine. By promoting cell adhesion and proliferation, these peptides can accelerate tissue repair and regeneration. The scientific community continues to explore the multifaceted potential of RGD peptides, with ongoing research focusing on synthesizing novel peptides, understanding their intricate molecular mechanisms, and developing clinically relevant applications.RGD peptide (GRGDNP) | Integrin-Iigand Interaction Inhibitor The precise determination of molecular weight and thorough characterization of the molecular formula and structure remain paramount in advancing the study and application of these versatile peptides.Chemical Properties ofRGD Peptide; M.Wt, 614.6 ; Solubility, DMF: 14 mg/ml,DMSO: 5 mg/ml,PBS (pH 7.2): 0.33 mg/ml ; General tips ...
Join the newsletter to receive news, updates, new products and freebies in your inbox.